C32H28ClN3O6S — CID 4289876
ethyl 2-[[2-[2-[[2-(4-chlorobenzoyl)oxynaphthalen-1-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4289876) has the molecular formula C32H28ClN3O6S and a molecular weight of 618.11 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[[2-(4-chlorobenzoyl)oxynaphthalen-1-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[[2-(4-chlorobenzoyl)oxynaphthalen-1-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4289876 |
| Molecular Formula | C32H28ClN3O6S |
| Molecular Weight | 618.11 g/mol |
| Exact Mass | 617.14 |
| IUPAC Name | ethyl 2-[[2-[2-[[2-(4-chlorobenzoyl)oxynaphthalen-1-yl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=Cc2c(OC(=O)c3ccc(Cl)cc3)ccc3ccccc23)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C32H28ClN3O6S/c1-3-41-32(40)27-23-14-8-18(2)16-26(23)43-30(27)35-28(37)29(38)36-34-17-24-22-7-5-4-6-19(22)11-15-25(24)42-31(39)20-9-12-21(33)13-10-20/h4-7,9-13,15,17-18H,3,8,14,16H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | DSTWYCISLGJXMJ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.11 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|