C29H29N3O7S — CID 124541174
ethyl (6S)-2-[[2-[(2Z)-2-[[3-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 124541174) has the molecular formula C29H29N3O7S and a molecular weight of 563.63 g/mol. Its IUPAC name is ethyl (6S)-2-[[2-[(2Z)-2-[[3-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6S)-2-[[2-[(2Z)-2-[[3-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 124541174 |
| Molecular Formula | C29H29N3O7S |
| Molecular Weight | 563.63 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | ethyl (6S)-2-[[2-[(2Z)-2-[[3-(4-methoxybenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)N/N=C\c2cccc(OC(=O)c3ccc(OC)cc3)c2)sc2c1CC[C@H](C)C2 |
| InChI | InChI=1S/C29H29N3O7S/c1-4-38-29(36)24-22-13-8-17(2)14-23(22)40-27(24)31-25(33)26(34)32-30-16-18-6-5-7-21(15-18)39-28(35)19-9-11-20(37-3)12-10-19/h5-7,9-12,15-17H,4,8,13-14H2,1-3H3,(H,31,33)(H,32,34)/b30-16-/t17-/m0/s1 |
| InChIKey | UVJLEKKNWBBAPI-BWSNBVSHSA-N |
| XLogP | 4.37 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.63 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|