C29H28BrN3O6S — CID 3287022
ethyl 2-[[2-[2-[[5-bromo-2-(3-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3287022) has the molecular formula C29H28BrN3O6S and a molecular weight of 626.53 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[[5-bromo-2-(3-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[[5-bromo-2-(3-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3287022 |
| Molecular Formula | C29H28BrN3O6S |
| Molecular Weight | 626.53 g/mol |
| Exact Mass | 625.09 |
| IUPAC Name | ethyl 2-[[2-[2-[[5-bromo-2-(3-methylbenzoyl)oxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=Cc2cc(Br)ccc2OC(=O)c2cccc(C)c2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C29H28BrN3O6S/c1-4-38-29(37)24-21-10-8-17(3)13-23(21)40-27(24)32-25(34)26(35)33-31-15-19-14-20(30)9-11-22(19)39-28(36)18-7-5-6-16(2)12-18/h5-7,9,11-12,14-15,17H,4,8,10,13H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | OTRXSXFZEXFMFK-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|