C21H22N4O6S — CID 5225837
ethyl 6-methyl-2-[[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5225837) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is ethyl 6-methyl-2-[[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 6-methyl-2-[[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5225837 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | ethyl 6-methyl-2-[[2-[2-[(3-nitrophenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=Cc2cccc([N+](=O)[O-])c2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C21H22N4O6S/c1-3-31-21(28)17-15-8-7-12(2)9-16(15)32-20(17)23-18(26)19(27)24-22-11-13-5-4-6-14(10-13)25(29)30/h4-6,10-12H,3,7-9H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | LORQSDXEDYYUGH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|