C43H60N2O8 — CID 3976097
ethyl N-[4-(3,4-dimethylphenoxy)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate (PubChem CID 3976097) has the molecular formula C43H60N2O8 and a molecular weight of 732.96 g/mol. Its IUPAC name is ethyl N-[4-(3,4-dimethylphenoxy)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate.
| Compound Name | ethyl N-[4-(3,4-dimethylphenoxy)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 3976097 |
| Molecular Formula | C43H60N2O8 |
| Molecular Weight | 732.96 g/mol |
| Exact Mass | 732.43 |
| IUPAC Name | ethyl N-[4-(3,4-dimethylphenoxy)-12-ethoxyimino-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
| SMILES | C=CCOC12Oc3ccc(Oc4ccc(C)c(C)c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCC)CC1N(CCC)C(=O)OCC)C32 |
| InChI | InChI=1S/C43H60N2O8/c1-7-21-45(42(48)49-9-3)39-28-37(44-51-10-4)35-26-31(15-11-13-22-46)34(16-12-14-23-47)40-36-27-33(52-32-18-17-29(5)30(6)25-32)19-20-38(36)53-43(39,41(35)40)50-24-8-2/h8,17-20,25-27,31,34,39-41,46-47H,2,7,9-16,21-24,28H2,1,3-6H3 |
| InChIKey | IOOGPTSNHMFSGN-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.96 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|