C41H56N2O8S — CID 3950344
methyl N-[12-ethoxyimino-15,16-bis(4-hydroxybutyl)-4-(4-methylsulfanylphenoxy)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate (PubChem CID 3950344) has the molecular formula C41H56N2O8S and a molecular weight of 736.97 g/mol. Its IUPAC name is methyl N-[12-ethoxyimino-15,16-bis(4-hydroxybutyl)-4-(4-methylsulfanylphenoxy)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate.
| Compound Name | methyl N-[12-ethoxyimino-15,16-bis(4-hydroxybutyl)-4-(4-methylsulfanylphenoxy)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 3950344 |
| Molecular Formula | C41H56N2O8S |
| Molecular Weight | 736.97 g/mol |
| Exact Mass | 736.38 |
| IUPAC Name | methyl N-[12-ethoxyimino-15,16-bis(4-hydroxybutyl)-4-(4-methylsulfanylphenoxy)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
| SMILES | C=CCOC12Oc3ccc(Oc4ccc(SC)cc4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCC)CC1N(CCC)C(=O)OC)C32 |
| InChI | InChI=1S/C41H56N2O8S/c1-6-21-43(40(46)47-4)37-27-35(42-49-8-3)33-25-28(13-9-11-22-44)32(14-10-12-23-45)38-34-26-30(50-29-15-18-31(52-5)19-16-29)17-20-36(34)51-41(37,39(33)38)48-24-7-2/h7,15-20,25-26,28,32,37-39,44-45H,2,6,8-14,21-24,27H2,1,3-5H3 |
| InChIKey | PZETVWZEDLNLOG-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.97 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|