C41H54N2O9 — CID 4560655
methyl N-[12-ethoxyimino-4-(3-formylphenoxy)-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate (PubChem CID 4560655) has the molecular formula C41H54N2O9 and a molecular weight of 718.89 g/mol. Its IUPAC name is methyl N-[12-ethoxyimino-4-(3-formylphenoxy)-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate.
| Compound Name | methyl N-[12-ethoxyimino-4-(3-formylphenoxy)-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 4560655 |
| Molecular Formula | C41H54N2O9 |
| Molecular Weight | 718.89 g/mol |
| Exact Mass | 718.38 |
| IUPAC Name | methyl N-[12-ethoxyimino-4-(3-formylphenoxy)-15,16-bis(4-hydroxybutyl)-9-prop-2-enoxy-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,13-tetraen-10-yl]-N-propylcarbamate |
| SMILES | C=CCOC12Oc3ccc(Oc4cccc(C=O)c4)cc3C3C(CCCCO)C(CCCCO)C=C(C(=NOCC)CC1N(CCC)C(=O)OC)C32 |
| InChI | InChI=1S/C41H54N2O9/c1-5-19-43(40(47)48-4)37-26-35(42-50-7-3)33-24-29(14-8-10-20-44)32(16-9-11-21-45)38-34-25-31(51-30-15-12-13-28(23-30)27-46)17-18-36(34)52-41(37,39(33)38)49-22-6-2/h6,12-13,15,17-18,23-25,27,29,32,37-39,44-45H,2,5,7-11,14,16,19-22,26H2,1,3-4H3 |
| InChIKey | GNXYFRKILQWWCG-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.89 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|