C24H26F3N3O2 — CID 39761771
N-(2,6-dimethylphenyl)-2-[4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide (PubChem CID 39761771) has the molecular formula C24H26F3N3O2 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-2-[4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2,6-dimethylphenyl)-2-[4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 39761771 |
| Molecular Formula | C24H26F3N3O2 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]piperazin-1-yl]acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCN(C(=O)/C=C/c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C24H26F3N3O2/c1-17-5-3-6-18(2)23(17)28-21(31)16-29-11-13-30(14-12-29)22(32)10-9-19-7-4-8-20(15-19)24(25,26)27/h3-10,15H,11-14,16H2,1-2H3,(H,28,31)/b10-9+ |
| InChIKey | NFPVTAFLLSJQOI-MDZDMXLPSA-N |
| XLogP | 4.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|