C21H22N2O2 — CID 39764939
N-phenyl-3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide (PubChem CID 39764939) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-phenyl-3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide.
| Compound Name | N-phenyl-3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide |
|---|---|
| PubChem CID | 39764939 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-phenyl-3-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide |
| SMILES | Cc1cc(C)c2c(c1)c(C)cc(=O)n2CCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H22N2O2/c1-14-11-16(3)21-18(12-14)15(2)13-20(25)23(21)10-9-19(24)22-17-7-5-4-6-8-17/h4-8,11-13H,9-10H2,1-3H3,(H,22,24) |
| InChIKey | DMBDMNNJBOSHHZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |