C10H7NO3S — CID 3976608
5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 3976608) has the molecular formula C10H7NO3S and a molecular weight of 221.24 g/mol. Its IUPAC name is 5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 3976608 |
| Molecular Formula | C10H7NO3S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.01 |
| IUPAC Name | 5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=CC=Cc2ccco2)S1 |
| InChI | InChI=1S/C10H7NO3S/c12-9-8(15-10(13)11-9)5-1-3-7-4-2-6-14-7/h1-6H,(H,11,12,13) |
| InChIKey | XKFYQGRJEQOFAV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|