C16H10Cl2N2O2S — CID 135399272
2-(2,4-dichlorophenyl)imino-5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 135399272) has the molecular formula C16H10Cl2N2O2S and a molecular weight of 365.24 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)imino-5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,4-dichlorophenyl)imino-5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135399272 |
| Molecular Formula | C16H10Cl2N2O2S |
| Molecular Weight | 365.24 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 2-(2,4-dichlorophenyl)imino-5-[3-(furan-2-yl)prop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N\c2ccc(Cl)cc2Cl)SC1=CC=Cc1ccco1 |
| InChI | InChI=1S/C16H10Cl2N2O2S/c17-10-6-7-13(12(18)9-10)19-16-20-15(21)14(23-16)5-1-3-11-4-2-8-22-11/h1-9H,(H,19,20,21) |
| InChIKey | IVQNFYONIXWLCZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.24 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|