C21H20N2O3 — CID 39768166
N-[4-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)acetyl]phenyl]acetamide (PubChem CID 39768166) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is N-[4-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)acetyl]phenyl]acetamide.
| Compound Name | N-[4-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)acetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 39768166 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[4-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)acetyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)Cn2c(=O)cc(C)c3cccc(C)c32)cc1 |
| InChI | InChI=1S/C21H20N2O3/c1-13-5-4-6-18-14(2)11-20(26)23(21(13)18)12-19(25)16-7-9-17(10-8-16)22-15(3)24/h4-11H,12H2,1-3H3,(H,22,24) |
| InChIKey | DDSWKMJQVQWWTA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |