C23H25N3O3 — CID 46301224
N-(4-acetamidophenyl)-2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanamide (PubChem CID 46301224) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanamide.
| Compound Name | N-(4-acetamidophenyl)-2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanamide |
|---|---|
| PubChem CID | 46301224 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-(4-acetamidophenyl)-2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(NC(C)=O)cc1)n1c(=O)cc(C)c2cccc(C)c21 |
| InChI | InChI=1S/C23H25N3O3/c1-5-20(23(29)25-18-11-9-17(10-12-18)24-16(4)27)26-21(28)13-15(3)19-8-6-7-14(2)22(19)26/h6-13,20H,5H2,1-4H3,(H,24,27)(H,25,29) |
| InChIKey | ZRVWKROJMBEXSZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |