C24H26N2O4 — CID 46301226
ethyl 3-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanoylamino]benzoate (PubChem CID 46301226) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is ethyl 3-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanoylamino]benzoate.
| Compound Name | ethyl 3-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 46301226 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 3-[2-(4,8-dimethyl-2-oxoquinolin-1-yl)butanoylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)C(CC)n2c(=O)cc(C)c3cccc(C)c32)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-5-20(23(28)25-18-11-8-10-17(14-18)24(29)30-6-2)26-21(27)13-16(4)19-12-7-9-15(3)22(19)26/h7-14,20H,5-6H2,1-4H3,(H,25,28) |
| InChIKey | DXQUMIBQLOAJQJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |