C22H24N2O2 — CID 46301191
2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(3-methylphenyl)butanamide (PubChem CID 46301191) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(3-methylphenyl)butanamide.
| Compound Name | 2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(3-methylphenyl)butanamide |
|---|---|
| PubChem CID | 46301191 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(3-methylphenyl)butanamide |
| SMILES | CCC(C(=O)Nc1cccc(C)c1)n1c(=O)cc(C)c2cccc(C)c21 |
| InChI | InChI=1S/C22H24N2O2/c1-5-19(22(26)23-17-10-6-8-14(2)12-17)24-20(25)13-16(4)18-11-7-9-15(3)21(18)24/h6-13,19H,5H2,1-4H3,(H,23,26) |
| InChIKey | AGPNNHRMJVTJMG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |