C26H33N3O4S — CID 46301387
N-[4-(diethylsulfamoyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)butanamide (PubChem CID 46301387) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)butanamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)butanamide |
|---|---|
| PubChem CID | 46301387 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(S(=O)(=O)N(CC)CC)cc1)n1c(=O)cc(C)c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C26H33N3O4S/c1-7-23(29-24(30)16-18(5)22-15-17(4)14-19(6)25(22)29)26(31)27-20-10-12-21(13-11-20)34(32,33)28(8-2)9-3/h10-16,23H,7-9H2,1-6H3,(H,27,31) |
| InChIKey | XMIKFCQATUUKOU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |