C27H33N3O4S — CID 46301342
N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide (PubChem CID 46301342) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide |
|---|---|
| PubChem CID | 46301342 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-2-(4,6,8-trimethyl-2-oxoquinolin-1-yl)propanamide |
| SMILES | Cc1cc(C)c2c(c1)c(C)cc(=O)n2C(C)C(=O)Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1 |
| InChI | InChI=1S/C27H33N3O4S/c1-18-15-20(3)26-24(16-18)19(2)17-25(31)30(26)21(4)27(32)28-22-9-11-23(12-10-22)35(33,34)29-13-7-5-6-8-14-29/h9-12,15-17,21H,5-8,13-14H2,1-4H3,(H,28,32) |
| InChIKey | FMSYKIOEJOIGGN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |