C27H31N5O3S2 — CID 46304363
N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide (PubChem CID 46304363) has the molecular formula C27H31N5O3S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide.
| Compound Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 46304363 |
| Molecular Formula | C27H31N5O3S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-(4-pyrrolidin-1-ylsulfonylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nnc2cc(C)c3cc(C)cc(C)c3n12)C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C27H31N5O3S2/c1-5-23(26(33)28-20-8-10-21(11-9-20)37(34,35)31-12-6-7-13-31)36-27-30-29-24-16-18(3)22-15-17(2)14-19(4)25(22)32(24)27/h8-11,14-16,23H,5-7,12-13H2,1-4H3,(H,28,33) |
| InChIKey | UCQYENXBDARGPV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |