C28H29N5O4S2 — CID 46304368
N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide (PubChem CID 46304368) has the molecular formula C28H29N5O4S2 and a molecular weight of 563.71 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide.
| Compound Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 46304368 |
| Molecular Formula | C28H29N5O4S2 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nnc2cc(C)c3cc(C)cc(C)c3n12)C(=O)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C28H29N5O4S2/c1-5-24(38-28-32-31-25-15-18(3)23-14-17(2)13-19(4)26(23)33(25)28)27(34)30-20-8-10-22(11-9-20)39(35,36)29-16-21-7-6-12-37-21/h6-15,24,29H,5,16H2,1-4H3,(H,30,34) |
| InChIKey | SHQYJIJABKZWAC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |