C27H27N5O3S2 — CID 46304384
ethyl 2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 46304384) has the molecular formula C27H27N5O3S2 and a molecular weight of 533.68 g/mol. Its IUPAC name is ethyl 2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 46304384 |
| Molecular Formula | C27H27N5O3S2 |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | ethyl 2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(NC(=O)C(CC)Sc3nnc4cc(C)c5cc(C)cc(C)c5n34)sc2c1 |
| InChI | InChI=1S/C27H27N5O3S2/c1-6-20(24(33)29-26-28-19-9-8-17(13-21(19)36-26)25(34)35-7-2)37-27-31-30-22-12-15(4)18-11-14(3)10-16(5)23(18)32(22)27/h8-13,20H,6-7H2,1-5H3,(H,28,29,33) |
| InChIKey | UYZCLWXVZJNBJE-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |