C24H27N5O3S2 — CID 46304439
ethyl 2-[2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 46304439) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is ethyl 2-[2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 46304439 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | ethyl 2-[2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(CC)Sc2nnc3cc(C)c4cc(C)cc(C)c4n23)n1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-6-18(22(31)26-23-25-16(12-33-23)11-20(30)32-7-2)34-24-28-27-19-10-14(4)17-9-13(3)8-15(5)21(17)29(19)24/h8-10,12,18H,6-7,11H2,1-5H3,(H,25,26,31) |
| InChIKey | IFCFFRGFTJJOER-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |