C25H28N4OS — CID 46304338
N-(2,4-dimethylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide (PubChem CID 46304338) has the molecular formula C25H28N4OS and a molecular weight of 432.59 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 46304338 |
| Molecular Formula | C25H28N4OS |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nnc2cc(C)c3cc(C)cc(C)c3n12)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C25H28N4OS/c1-7-21(24(30)26-20-9-8-14(2)10-17(20)5)31-25-28-27-22-13-16(4)19-12-15(3)11-18(6)23(19)29(22)25/h8-13,21H,7H2,1-6H3,(H,26,30) |
| InChIKey | WLHGFNNDMAQGTP-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |