C24H26N4OS — CID 46304393
N-(2,5-dimethylphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide (PubChem CID 46304393) has the molecular formula C24H26N4OS and a molecular weight of 418.57 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide.
| Compound Name | N-(2,5-dimethylphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 46304393 |
| Molecular Formula | C24H26N4OS |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)CCSc2nnc3cc(C)c4cc(C)cc(C)c4n23)c1 |
| InChI | InChI=1S/C24H26N4OS/c1-14-6-7-16(3)20(12-14)25-22(29)8-9-30-24-27-26-21-13-17(4)19-11-15(2)10-18(5)23(19)28(21)24/h6-7,10-13H,8-9H2,1-5H3,(H,25,29) |
| InChIKey | CYGJIXNHULCXNZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |