C24H26N4O3S — CID 39758475
N-(2,4-dimethoxyphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide (PubChem CID 39758475) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 39758475 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]propanamide |
| SMILES | COc1ccc(NC(=O)CCSc2nnc3cc(C)c4cc(C)cc(C)c4n23)c(OC)c1 |
| InChI | InChI=1S/C24H26N4O3S/c1-14-10-16(3)23-18(11-14)15(2)12-21-26-27-24(28(21)23)32-9-8-22(29)25-19-7-6-17(30-4)13-20(19)31-5/h6-7,10-13H,8-9H2,1-5H3,(H,25,29) |
| InChIKey | KGFHBKYXSGUHBY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |