C25H28N4O3S2 — CID 46304468
methyl 4,5-dimethyl-2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]thiophene-3-carboxylate (PubChem CID 46304468) has the molecular formula C25H28N4O3S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is methyl 4,5-dimethyl-2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4,5-dimethyl-2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46304468 |
| Molecular Formula | C25H28N4O3S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | methyl 4,5-dimethyl-2-[2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanoylamino]thiophene-3-carboxylate |
| SMILES | CCC(Sc1nnc2cc(C)c3cc(C)cc(C)c3n12)C(=O)Nc1sc(C)c(C)c1C(=O)OC |
| InChI | InChI=1S/C25H28N4O3S2/c1-8-18(22(30)26-23-20(24(31)32-7)15(5)16(6)33-23)34-25-28-27-19-11-13(3)17-10-12(2)9-14(4)21(17)29(19)25/h9-11,18H,8H2,1-7H3,(H,26,30) |
| InChIKey | KOJBPDYOZWVVKS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |