C26H24ClN5OS2 — CID 46304432
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide (PubChem CID 46304432) has the molecular formula C26H24ClN5OS2 and a molecular weight of 522.10 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 46304432 |
| Molecular Formula | C26H24ClN5OS2 |
| Molecular Weight | 522.10 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-[(5,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1nnc2cc(C)c3cc(C)cc(C)c3n12)C(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C26H24ClN5OS2/c1-5-21(24(33)29-25-28-20(13-34-25)17-6-8-18(27)9-7-17)35-26-31-30-22-12-15(3)19-11-14(2)10-16(4)23(19)32(22)26/h6-13,21H,5H2,1-4H3,(H,28,29,33) |
| InChIKey | IOSTVPYHPIQDKX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.10 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |