C25H22N6O3S2 — CID 46304191
2-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 46304191) has the molecular formula C25H22N6O3S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 2-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 46304191 |
| Molecular Formula | C25H22N6O3S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-[(5,9-dimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CCC(Sc1nnc2cc(C)c3cccc(C)c3n12)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C25H22N6O3S2/c1-4-20(23(32)27-24-26-19(13-35-24)16-8-6-9-17(12-16)31(33)34)36-25-29-28-21-11-15(3)18-10-5-7-14(2)22(18)30(21)25/h5-13,20H,4H2,1-3H3,(H,26,27,32) |
| InChIKey | YYKSGMMXTGZXMR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|