C18H19N7O5S2 — CID 46306475
ethyl 2-[[5-amino-4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 46306475) has the molecular formula C18H19N7O5S2 and a molecular weight of 477.53 g/mol. Its IUPAC name is ethyl 2-[[5-amino-4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[5-amino-4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 46306475 |
| Molecular Formula | C18H19N7O5S2 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | ethyl 2-[[5-amino-4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nnc(N)n1C(C)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C18H19N7O5S2/c1-3-30-14(26)9-32-18-23-22-16(19)24(18)10(2)15(27)21-17-20-13(8-31-17)11-5-4-6-12(7-11)25(28)29/h4-8,10H,3,9H2,1-2H3,(H2,19,22)(H,20,21,27) |
| InChIKey | OOZJHJZFAYGVKQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 168.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|