C18H17N5O4S — CID 46304510
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 46304510) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 46304510 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | Cc1cc(C)n(C(C)C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)c(=O)n1 |
| InChI | InChI=1S/C18H17N5O4S/c1-10-7-11(2)22(18(25)19-10)12(3)16(24)21-17-20-15(9-28-17)13-5-4-6-14(8-13)23(26)27/h4-9,12H,1-3H3,(H,20,21,24) |
| InChIKey | LPLVBQOVMSPEEN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|