C23H26N2O3 — CID 46301214
2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(2-ethoxyphenyl)butanamide (PubChem CID 46301214) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(2-ethoxyphenyl)butanamide.
| Compound Name | 2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(2-ethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 46301214 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-(4,8-dimethyl-2-oxoquinolin-1-yl)-N-(2-ethoxyphenyl)butanamide |
| SMILES | CCOc1ccccc1NC(=O)C(CC)n1c(=O)cc(C)c2cccc(C)c21 |
| InChI | InChI=1S/C23H26N2O3/c1-5-19(23(27)24-18-12-7-8-13-20(18)28-6-2)25-21(26)14-16(4)17-11-9-10-15(3)22(17)25/h7-14,19H,5-6H2,1-4H3,(H,24,27) |
| InChIKey | VKUWZPNMQJXQIR-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |