C12H9FN6O4 — CID 3978268
N-(4-fluoro-3-nitrophenyl)-7-oxo-5,6-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide (PubChem CID 3978268) has the molecular formula C12H9FN6O4 and a molecular weight of 320.24 g/mol. Its IUPAC name is N-(4-fluoro-3-nitrophenyl)-7-oxo-5,6-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide.
| Compound Name | N-(4-fluoro-3-nitrophenyl)-7-oxo-5,6-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 3978268 |
| Molecular Formula | C12H9FN6O4 |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(4-fluoro-3-nitrophenyl)-7-oxo-5,6-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(F)c([N+](=O)[O-])c1)C1CC(=O)n2ncnc2N1 |
| InChI | InChI=1S/C12H9FN6O4/c13-7-2-1-6(3-9(7)19(22)23)16-11(21)8-4-10(20)18-12(17-8)14-5-15-18/h1-3,5,8H,4H2,(H,16,21)(H,14,15,17) |
| InChIKey | UIXPLSNPHWUTPL-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|