C20H20FN5O5 — CID 1443606
(2R)-2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 1443606) has the molecular formula C20H20FN5O5 and a molecular weight of 429.41 g/mol. Its IUPAC name is (2R)-2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2R)-2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 1443606 |
| Molecular Formula | C20H20FN5O5 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (2R)-2-N-(4-acetamidophenyl)-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H]2CCCN2C(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H20FN5O5/c1-12(27)22-13-4-6-14(7-5-13)23-19(28)17-3-2-10-25(17)20(29)24-15-8-9-16(21)18(11-15)26(30)31/h4-9,11,17H,2-3,10H2,1H3,(H,22,27)(H,23,28)(H,24,29)/t17-/m1/s1 |
| InChIKey | UKFNLQKVAPSNCR-QGZVFWFLSA-N |
| XLogP | 3.33 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|