C16H21FN4O4 — CID 3230357
2-N-tert-butyl-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 3230357) has the molecular formula C16H21FN4O4 and a molecular weight of 352.37 g/mol. Its IUPAC name is 2-N-tert-butyl-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-tert-butyl-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 3230357 |
| Molecular Formula | C16H21FN4O4 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-N-tert-butyl-1-N-(4-fluoro-3-nitrophenyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)C1CCCN1C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H21FN4O4/c1-16(2,3)19-14(22)12-5-4-8-20(12)15(23)18-10-6-7-11(17)13(9-10)21(24)25/h6-7,9,12H,4-5,8H2,1-3H3,(H,18,23)(H,19,22) |
| InChIKey | KOYDEURSWHPRRJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|