C27H31NO5S — CID 3980465
ethyl 2-[2-(adamantane-1-carbonyloxy)propanoylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 3980465) has the molecular formula C27H31NO5S and a molecular weight of 481.61 g/mol. Its IUPAC name is ethyl 2-[2-(adamantane-1-carbonyloxy)propanoylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[2-(adamantane-1-carbonyloxy)propanoylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3980465 |
| Molecular Formula | C27H31NO5S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | ethyl 2-[2-(adamantane-1-carbonyloxy)propanoylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)C(C)OC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H31NO5S/c1-3-32-25(30)21-12-22(20-7-5-4-6-8-20)34-24(21)28-23(29)16(2)33-26(31)27-13-17-9-18(14-27)11-19(10-17)15-27/h4-8,12,16-19H,3,9-11,13-15H2,1-2H3,(H,28,29) |
| InChIKey | VXIZYYAXKNFZLF-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |