C22H25NO6S — CID 55375119
[1-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-1-oxopropan-2-yl] oxane-4-carboxylate (PubChem CID 55375119) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is [1-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-1-oxopropan-2-yl] oxane-4-carboxylate.
| Compound Name | [1-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-1-oxopropan-2-yl] oxane-4-carboxylate |
|---|---|
| PubChem CID | 55375119 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [1-[(3-ethoxycarbonyl-5-phenylthiophen-2-yl)amino]-1-oxopropan-2-yl] oxane-4-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)C(C)OC(=O)C1CCOCC1 |
| InChI | InChI=1S/C22H25NO6S/c1-3-28-22(26)17-13-18(15-7-5-4-6-8-15)30-20(17)23-19(24)14(2)29-21(25)16-9-11-27-12-10-16/h4-8,13-14,16H,3,9-12H2,1-2H3,(H,23,24) |
| InChIKey | ZRCXQCIWZXNBDZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |