C35H27N3OS — CID 3980492
1-(1,3',3',4-tetraphenylspiro[1,2,4-triazole-5,1'-2-benzothiophene]-3-yl)ethanone (PubChem CID 3980492) has the molecular formula C35H27N3OS and a molecular weight of 537.69 g/mol. Its IUPAC name is 1-(1,3',3',4-tetraphenylspiro[1,2,4-triazole-5,1'-2-benzothiophene]-3-yl)ethanone.
| Compound Name | 1-(1,3',3',4-tetraphenylspiro[1,2,4-triazole-5,1'-2-benzothiophene]-3-yl)ethanone |
|---|---|
| PubChem CID | 3980492 |
| Molecular Formula | C35H27N3OS |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 1-(1,3',3',4-tetraphenylspiro[1,2,4-triazole-5,1'-2-benzothiophene]-3-yl)ethanone |
| SMILES | CC(=O)C1=NN(c2ccccc2)C2(SC(c3ccccc3)(c3ccccc3)c3ccccc32)N1c1ccccc1 |
| InChI | InChI=1S/C35H27N3OS/c1-26(39)33-36-38(30-22-12-5-13-23-30)35(37(33)29-20-10-4-11-21-29)32-25-15-14-24-31(32)34(40-35,27-16-6-2-7-17-27)28-18-8-3-9-19-28/h2-25H,1H3 |
| InChIKey | CQJGWOXYIIVCDN-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |