C25H21N5O3S — CID 40926934
1-[(5S)-4'-ethyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-yl]ethanone (PubChem CID 40926934) has the molecular formula C25H21N5O3S and a molecular weight of 471.54 g/mol. Its IUPAC name is 1-[(5S)-4'-ethyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-yl]ethanone.
| Compound Name | 1-[(5S)-4'-ethyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-yl]ethanone |
|---|---|
| PubChem CID | 40926934 |
| Molecular Formula | C25H21N5O3S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-[(5S)-4'-ethyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-yl]ethanone |
| SMILES | CCC1=NN(c2ccccc2)[C@@]2(SC(C(C)=O)=NN2c2ccc([N+](=O)[O-])cc2)c2ccccc21 |
| InChI | InChI=1S/C25H21N5O3S/c1-3-23-21-11-7-8-12-22(21)25(28(26-23)18-9-5-4-6-10-18)29(27-24(34-25)17(2)31)19-13-15-20(16-14-19)30(32)33/h4-16H,3H2,1-2H3/t25-/m0/s1 |
| InChIKey | CFXJCALTKUICOP-VWLOTQADSA-N |
| XLogP | 5.50 |
| TPSA | 91.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|