C21H18N4O5S2 — CID 40965063
methyl (5R)-2-acetyl-8-methyl-4-(4-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-7-carboxylate (PubChem CID 40965063) has the molecular formula C21H18N4O5S2 and a molecular weight of 470.53 g/mol. Its IUPAC name is methyl (5R)-2-acetyl-8-methyl-4-(4-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-7-carboxylate.
| Compound Name | methyl (5R)-2-acetyl-8-methyl-4-(4-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-7-carboxylate |
|---|---|
| PubChem CID | 40965063 |
| Molecular Formula | C21H18N4O5S2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | methyl (5R)-2-acetyl-8-methyl-4-(4-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-7-carboxylate |
| SMILES | COC(=O)C1=C(C)N(c2ccccc2)[C@]2(SC(C(C)=O)=NN2c2ccc([N+](=O)[O-])cc2)S1 |
| InChI | InChI=1S/C21H18N4O5S2/c1-13-18(20(27)30-3)31-21(23(13)15-7-5-4-6-8-15)24(22-19(32-21)14(2)26)16-9-11-17(12-10-16)25(28)29/h4-12H,1-3H3/t21-/m1/s1 |
| InChIKey | HFWYKLNDQZKLPV-OAQYLSRUSA-N |
| XLogP | 4.32 |
| TPSA | 105.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|