C28H25N5O3S — CID 41011101
1-[(5S)-4-(4-nitrophenyl)-10-phenyl-8-(4-propan-2-ylphenyl)-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-trien-2-yl]ethanone (PubChem CID 41011101) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is 1-[(5S)-4-(4-nitrophenyl)-10-phenyl-8-(4-propan-2-ylphenyl)-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-trien-2-yl]ethanone.
| Compound Name | 1-[(5S)-4-(4-nitrophenyl)-10-phenyl-8-(4-propan-2-ylphenyl)-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-trien-2-yl]ethanone |
|---|---|
| PubChem CID | 41011101 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | 1-[(5S)-4-(4-nitrophenyl)-10-phenyl-8-(4-propan-2-ylphenyl)-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-trien-2-yl]ethanone |
| SMILES | CC(=O)C1=NN(c2ccc([N+](=O)[O-])cc2)[C@@]2(C=CC(c3ccc(C(C)C)cc3)=NN2c2ccccc2)S1 |
| InChI | InChI=1S/C28H25N5O3S/c1-19(2)21-9-11-22(12-10-21)26-17-18-28(31(29-26)23-7-5-4-6-8-23)32(30-27(37-28)20(3)34)24-13-15-25(16-14-24)33(35)36/h4-19H,1-3H3/t28-/m0/s1 |
| InChIKey | WRBBLJZICAELSM-NDEPHWFRSA-N |
| XLogP | 6.31 |
| TPSA | 91.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|