C28H25N5O4S — CID 4261672
ethyl 8-(4-ethylphenyl)-4-(2-nitrophenyl)-10-phenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-triene-2-carboxylate (PubChem CID 4261672) has the molecular formula C28H25N5O4S and a molecular weight of 527.61 g/mol. Its IUPAC name is ethyl 8-(4-ethylphenyl)-4-(2-nitrophenyl)-10-phenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-triene-2-carboxylate.
| Compound Name | ethyl 8-(4-ethylphenyl)-4-(2-nitrophenyl)-10-phenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-triene-2-carboxylate |
|---|---|
| PubChem CID | 4261672 |
| Molecular Formula | C28H25N5O4S |
| Molecular Weight | 527.61 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | ethyl 8-(4-ethylphenyl)-4-(2-nitrophenyl)-10-phenyl-1-thia-3,4,9,10-tetrazaspiro[4.5]deca-2,6,8-triene-2-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccccc2[N+](=O)[O-])C2(C=CC(c3ccc(CC)cc3)=NN2c2ccccc2)S1 |
| InChI | InChI=1S/C28H25N5O4S/c1-3-20-14-16-21(17-15-20)23-18-19-28(31(29-23)22-10-6-5-7-11-22)32(30-26(38-28)27(34)37-4-2)24-12-8-9-13-25(24)33(35)36/h5-19H,3-4H2,1-2H3 |
| InChIKey | ASBROZSMOZBREZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 100.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|