C22H20N4O6S2 — CID 40927024
7-O-ethyl 2-O-methyl (5S)-8-methyl-4-(2-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate (PubChem CID 40927024) has the molecular formula C22H20N4O6S2 and a molecular weight of 500.56 g/mol. Its IUPAC name is 7-O-ethyl 2-O-methyl (5S)-8-methyl-4-(2-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate.
| Compound Name | 7-O-ethyl 2-O-methyl (5S)-8-methyl-4-(2-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 40927024 |
| Molecular Formula | C22H20N4O6S2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 7-O-ethyl 2-O-methyl (5S)-8-methyl-4-(2-nitrophenyl)-9-phenyl-1,6-dithia-3,4,9-triazaspiro[4.4]nona-2,7-diene-2,7-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(c2ccccc2)[C@@]2(SC(C(=O)OC)=NN2c2ccccc2[N+](=O)[O-])S1 |
| InChI | InChI=1S/C22H20N4O6S2/c1-4-32-20(27)18-14(2)24(15-10-6-5-7-11-15)22(33-18)25(23-19(34-22)21(28)31-3)16-12-8-9-13-17(16)26(29)30/h5-13H,4H2,1-3H3/t22-/m0/s1 |
| InChIKey | ICBYBZNBEBFEMA-QFIPXVFZSA-N |
| XLogP | 4.29 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|