C24H19N5O4S — CID 40849849
methyl (5R)-4'-methyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-carboxylate (PubChem CID 40849849) has the molecular formula C24H19N5O4S and a molecular weight of 473.51 g/mol. Its IUPAC name is methyl (5R)-4'-methyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-carboxylate.
| Compound Name | methyl (5R)-4'-methyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-carboxylate |
|---|---|
| PubChem CID | 40849849 |
| Molecular Formula | C24H19N5O4S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | methyl (5R)-4'-methyl-4-(4-nitrophenyl)-2'-phenylspiro[1,3,4-thiadiazole-5,1'-phthalazine]-2-carboxylate |
| SMILES | COC(=O)C1=NN(c2ccc([N+](=O)[O-])cc2)[C@@]2(S1)c1ccccc1C(C)=NN2c1ccccc1 |
| InChI | InChI=1S/C24H19N5O4S/c1-16-20-10-6-7-11-21(20)24(27(25-16)17-8-4-3-5-9-17)28(26-22(34-24)23(30)33-2)18-12-14-19(15-13-18)29(31)32/h3-15H,1-2H3/t24-/m1/s1 |
| InChIKey | XOIIBHMUAGRWHD-XMMPIXPASA-N |
| XLogP | 4.69 |
| TPSA | 100.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|