C22H24N4O2S2 — CID 39815270
2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 39815270) has the molecular formula C22H24N4O2S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 39815270 |
| Molecular Formula | C22H24N4O2S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[[5-(3-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-methyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | COc1cccc(Nc2nnc(SCC(=O)N(C)[C@@H]3CCCc4ccccc43)s2)c1 |
| InChI | InChI=1S/C22H24N4O2S2/c1-26(19-12-5-8-15-7-3-4-11-18(15)19)20(27)14-29-22-25-24-21(30-22)23-16-9-6-10-17(13-16)28-2/h3-4,6-7,9-11,13,19H,5,8,12,14H2,1-2H3,(H,23,24)/t19-/m1/s1 |
| InChIKey | YCCIHGYJCMHLDK-LJQANCHMSA-N |
| XLogP | 4.92 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |