C22H24N4O2S2 — CID 41144667
2-[[5-(4-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide (PubChem CID 41144667) has the molecular formula C22H24N4O2S2 and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[[5-(4-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide.
| Compound Name | 2-[[5-(4-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
|---|---|
| PubChem CID | 41144667 |
| Molecular Formula | C22H24N4O2S2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 2-[[5-(4-ethoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]acetamide |
| SMILES | CCOc1ccc(Nc2nnc(SCC(=O)N[C@H]3CCCc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C22H24N4O2S2/c1-2-28-17-12-10-16(11-13-17)23-21-25-26-22(30-21)29-14-20(27)24-19-9-5-7-15-6-3-4-8-18(15)19/h3-4,6,8,10-13,19H,2,5,7,9,14H2,1H3,(H,23,25)(H,24,27)/t19-/m0/s1 |
| InChIKey | XWZIZKOHSXZUGC-IBGZPJMESA-N |
| XLogP | 4.97 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |