C21H22N4OS2 — CID 3382956
2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 3382956) has the molecular formula C21H22N4OS2 and a molecular weight of 410.57 g/mol. Its IUPAC name is 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 3382956 |
| Molecular Formula | C21H22N4OS2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 2-[[5-(benzylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(CSc1nnc(NCc2ccccc2)s1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C21H22N4OS2/c26-19(23-18-12-6-10-16-9-4-5-11-17(16)18)14-27-21-25-24-20(28-21)22-13-15-7-2-1-3-8-15/h1-5,7-9,11,18H,6,10,12-14H2,(H,22,24)(H,23,26) |
| InChIKey | GCQAEBZXPVAPRX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |