C20H19FN4OS2 — CID 23828482
2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 23828482) has the molecular formula C20H19FN4OS2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 23828482 |
| Molecular Formula | C20H19FN4OS2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[[5-(2-fluoroanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(CSc1nnc(Nc2ccccc2F)s1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C20H19FN4OS2/c21-15-9-3-4-10-17(15)23-19-24-25-20(28-19)27-12-18(26)22-16-11-5-7-13-6-1-2-8-14(13)16/h1-4,6,8-10,16H,5,7,11-12H2,(H,22,26)(H,23,24) |
| InChIKey | HXECNBJPNQMELB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |