About bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc
bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc (PubChem CID 3981694) has the molecular formula C18H22N6S2Zn
and a molecular weight of 451.94 g/mol. Its IUPAC name is bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc.
Molecular Properties
| Compound Name | bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc |
| PubChem CID | 3981694 |
| Molecular Formula | C18H22N6S2Zn |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc |
| SMILES | [H]/[S+]=C(\N)[N-]N=C(C)c1ccccc1.[H]/[S+]=C(\N)[N-]N=C(C)c1ccccc1.[Zn] |
| InChI | InChI=1S/2C9H11N3S.Zn/c2*1-7(11-12-9(10)13)8-5-3-2-4-6-8;/h2*2-6H,1H3,(H3,10,12,13); |
| InChIKey | KDHXLJGBQVHVHN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc?
The IUPAC name of bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc (CID 3981694) is bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc.
What is the SMILES notation for bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc?
The canonical SMILES for bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc is [H]/[S+]=C(\N)[N-]N=C(C)c1ccccc1.[H]/[S+]=C(\N)[N-]N=C(C)c1ccccc1.[Zn].
What is the InChIKey of bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc?
The InChIKey is KDHXLJGBQVHVHN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H11N3S.Zn/c2*1-7(11-12-9(10)13)8-5-3-2-4-6-8;/h2*2-6H,1H3,(H3,10,12,13);.
What are the key properties of bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc?
bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc has a molecular weight of 451.94 g/mol, XLogP of 2.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis([amino(sulfoniumylidene)methyl]-(1-phenylethylideneamino)azanide);zinc is sourced from PubChem (CID 3981694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).