C15H15N3O3S2 — CID 3982998
N-ethoxy-2-[(4-methyl-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3-thiazole-4-carboxamide (PubChem CID 3982998) has the molecular formula C15H15N3O3S2 and a molecular weight of 349.44 g/mol. Its IUPAC name is N-ethoxy-2-[(4-methyl-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethoxy-2-[(4-methyl-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3982998 |
| Molecular Formula | C15H15N3O3S2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-ethoxy-2-[(4-methyl-1,3-benzoxazol-2-yl)sulfanylmethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCONC(=O)c1csc(CSc2nc3c(C)cccc3o2)n1 |
| InChI | InChI=1S/C15H15N3O3S2/c1-3-20-18-14(19)10-7-22-12(16-10)8-23-15-17-13-9(2)5-4-6-11(13)21-15/h4-7H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | IFXYOQMSUQDSEB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|