C11H8N4OS — CID 39834270
N-(1H-pyrazol-5-yl)-1,3-benzothiazole-5-carboxamide (PubChem CID 39834270) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is N-(1H-pyrazol-5-yl)-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-(1H-pyrazol-5-yl)-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 39834270 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | N-(1H-pyrazol-5-yl)-1,3-benzothiazole-5-carboxamide |
| SMILES | O=C(Nc1ccn[nH]1)c1ccc2scnc2c1 |
| InChI | InChI=1S/C11H8N4OS/c16-11(14-10-3-4-13-15-10)7-1-2-9-8(5-7)12-6-17-9/h1-6H,(H2,13,14,15,16) |
| InChIKey | YHQXYNPGPNWCCN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |