C15H12N4O3 — CID 25256604
2-N-hydroxy-7-N-(1H-pyrazol-5-yl)naphthalene-2,7-dicarboxamide (PubChem CID 25256604) has the molecular formula C15H12N4O3 and a molecular weight of 296.29 g/mol. Its IUPAC name is 2-N-hydroxy-7-N-(1H-pyrazol-5-yl)naphthalene-2,7-dicarboxamide.
| Compound Name | 2-N-hydroxy-7-N-(1H-pyrazol-5-yl)naphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 25256604 |
| Molecular Formula | C15H12N4O3 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-N-hydroxy-7-N-(1H-pyrazol-5-yl)naphthalene-2,7-dicarboxamide |
| SMILES | O=C(NO)c1ccc2ccc(C(=O)Nc3ccn[nH]3)cc2c1 |
| InChI | InChI=1S/C15H12N4O3/c20-14(17-13-5-6-16-18-13)10-3-1-9-2-4-11(15(21)19-22)8-12(9)7-10/h1-8,22H,(H,19,21)(H2,16,17,18,20) |
| InChIKey | CXZWCXPSKNRACQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|